C32H22N2O2S — CID 122486640
12-(3,5-diphenylphenyl)-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide (PubChem CID 122486640) has the molecular formula C32H22N2O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is 12-(3,5-diphenylphenyl)-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide.
| Compound Name | 12-(3,5-diphenylphenyl)-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486640 |
| Molecular Formula | C32H22N2O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 12-(3,5-diphenylphenyl)-15-methyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide |
| SMILES | Cc1nc2c(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)ccc3c2n1-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C32H22N2O2S/c1-21-33-31-27(16-17-30-32(31)34(21)28-14-8-9-15-29(28)37(30,35)36)26-19-24(22-10-4-2-5-11-22)18-25(20-26)23-12-6-3-7-13-23/h2-20H,1H3 |
| InChIKey | XZGKFJZBFCVLCW-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |