C27H19N3O2S — CID 122486655
12-carbazol-9-yl-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide (PubChem CID 122486655) has the molecular formula C27H19N3O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 12-carbazol-9-yl-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide.
| Compound Name | 12-carbazol-9-yl-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486655 |
| Molecular Formula | C27H19N3O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 12-carbazol-9-yl-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene 8,8-dioxide |
| SMILES | CCc1nc2c(-n3c4ccccc4c4ccccc43)ccc3c2n1-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C27H19N3O2S/c1-2-25-28-26-22(29-19-11-5-3-9-17(19)18-10-4-6-12-20(18)29)15-16-24-27(26)30(25)21-13-7-8-14-23(21)33(24,31)32/h3-16H,2H2,1H3 |
| InChIKey | PXKBVILPVPIZDO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |