C20H15N3O2S — CID 122486626
15-ethyl-11-pyridin-4-yl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide (PubChem CID 122486626) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 15-ethyl-11-pyridin-4-yl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide.
| Compound Name | 15-ethyl-11-pyridin-4-yl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 122486626 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 15-ethyl-11-pyridin-4-yl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide |
| SMILES | CCc1nc2cc(-c3ccncc3)cc3c2n1-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C20H15N3O2S/c1-2-19-22-15-11-14(13-7-9-21-10-8-13)12-18-20(15)23(19)16-5-3-4-6-17(16)26(18,24)25/h3-12H,2H2,1H3 |
| InChIKey | XBCZLNXJQGDPLD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |