C30H24N5O2S+3 — CID 154612700
10-(3,5-diphenyl-1,3,5-triazine-1,3,5-triium-1-yl)-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide (PubChem CID 154612700) has the molecular formula C30H24N5O2S+3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 10-(3,5-diphenyl-1,3,5-triazine-1,3,5-triium-1-yl)-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide.
| Compound Name | 10-(3,5-diphenyl-1,3,5-triazine-1,3,5-triium-1-yl)-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide |
|---|---|
| PubChem CID | 154612700 |
| Molecular Formula | C30H24N5O2S+3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 10-(3,5-diphenyl-1,3,5-triazine-1,3,5-triium-1-yl)-15-ethyl-8λ6-thia-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8,8-dioxide |
| SMILES | CCc1nc2ccc(-[n+]3c[n+](-c4ccccc4)c[n+](-c4ccccc4)c3)c3c2n1-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C30H24N5O2S/c1-2-28-31-24-17-18-26(30-29(24)35(28)25-15-9-10-16-27(25)38(30,36)37)34-20-32(22-11-5-3-6-12-22)19-33(21-34)23-13-7-4-8-14-23/h3-21H,2H2,1H3/q+3 |
| InChIKey | AOXMIYIUIFCHIQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|