C52H34N2O2S — CID 71202877
3,8-bis(3,5-diphenylphenyl)-17λ6-thia-1,10-diazapentacyclo[8.7.2.04,18.07,19.011,16]nonadeca-2,4(18),5,7(19),8,11,13,15-octaene 17,17-dioxide (PubChem CID 71202877) has the molecular formula C52H34N2O2S and a molecular weight of 750.92 g/mol. Its IUPAC name is 3,8-bis(3,5-diphenylphenyl)-17λ6-thia-1,10-diazapentacyclo[8.7.2.04,18.07,19.011,16]nonadeca-2,4(18),5,7(19),8,11,13,15-octaene 17,17-dioxide.
| Compound Name | 3,8-bis(3,5-diphenylphenyl)-17λ6-thia-1,10-diazapentacyclo[8.7.2.04,18.07,19.011,16]nonadeca-2,4(18),5,7(19),8,11,13,15-octaene 17,17-dioxide |
|---|---|
| PubChem CID | 71202877 |
| Molecular Formula | C52H34N2O2S |
| Molecular Weight | 750.92 g/mol |
| Exact Mass | 750.23 |
| IUPAC Name | 3,8-bis(3,5-diphenylphenyl)-17λ6-thia-1,10-diazapentacyclo[8.7.2.04,18.07,19.011,16]nonadeca-2,4(18),5,7(19),8,11,13,15-octaene 17,17-dioxide |
| SMILES | O=S1(=O)c2ccccc2-n2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4c(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)cn1c4c32 |
| InChI | InChI=1S/C52H34N2O2S/c55-57(56)50-24-14-13-23-49(50)53-33-47(43-29-39(35-15-5-1-6-16-35)27-40(30-43)36-17-7-2-8-18-36)45-25-26-46-48(34-54(57)52(46)51(45)53)44-31-41(37-19-9-3-10-20-37)28-42(32-44)38-21-11-4-12-22-38/h1-34H |
| InChIKey | XUCGRWHSNKBAAJ-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.92 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |