C23H23N3O2 — CID 122495143
6-(4-aminocyclohexyl)oxy-4-(1-benzofuran-2-yl)isoquinolin-1-amine (PubChem CID 122495143) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 6-(4-aminocyclohexyl)oxy-4-(1-benzofuran-2-yl)isoquinolin-1-amine.
| Compound Name | 6-(4-aminocyclohexyl)oxy-4-(1-benzofuran-2-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 122495143 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 6-(4-aminocyclohexyl)oxy-4-(1-benzofuran-2-yl)isoquinolin-1-amine |
| SMILES | Nc1ncc(-c2cc3ccccc3o2)c2cc(OC3CCC(N)CC3)ccc12 |
| InChI | InChI=1S/C23H23N3O2/c24-15-5-7-16(8-6-15)27-17-9-10-18-19(12-17)20(13-26-23(18)25)22-11-14-3-1-2-4-21(14)28-22/h1-4,9-13,15-16H,5-8,24H2,(H2,25,26) |
| InChIKey | XEDVXLGVHBWAMI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |