C17H25Cl2N3O3S — CID 122501360
tert-butyl (3R)-3-(tert-butylsulfinylamino)-5,7-dichloro-3-methyl-2H-pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 122501360) has the molecular formula C17H25Cl2N3O3S and a molecular weight of 422.38 g/mol. Its IUPAC name is tert-butyl (3R)-3-(tert-butylsulfinylamino)-5,7-dichloro-3-methyl-2H-pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(tert-butylsulfinylamino)-5,7-dichloro-3-methyl-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 122501360 |
| Molecular Formula | C17H25Cl2N3O3S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | tert-butyl (3R)-3-(tert-butylsulfinylamino)-5,7-dichloro-3-methyl-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@](C)(NS(=O)C(C)(C)C)c2cc(Cl)nc(Cl)c21 |
| InChI | InChI=1S/C17H25Cl2N3O3S/c1-15(2,3)25-14(23)22-9-17(7,21-26(24)16(4,5)6)10-8-11(18)20-13(19)12(10)22/h8,21H,9H2,1-7H3/t17-,26?/m0/s1 |
| InChIKey | BDGLUDFEHHFHOB-WFFHQLTOSA-N |
| XLogP | 4.41 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|