C17H10F3N5O — CID 122506750
2-(2,4-difluorophenyl)-6-[(2-fluoro-4-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine (PubChem CID 122506750) has the molecular formula C17H10F3N5O and a molecular weight of 357.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-6-[(2-fluoro-4-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 2-(2,4-difluorophenyl)-6-[(2-fluoro-4-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 122506750 |
| Molecular Formula | C17H10F3N5O |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-6-[(2-fluoro-4-pyridinyl)oxymethyl]imidazo[1,2-b][1,2,4]triazine |
| SMILES | Fc1ccc(-c2cnc3nc(COc4ccnc(F)c4)cn3n2)c(F)c1 |
| InChI | InChI=1S/C17H10F3N5O/c18-10-1-2-13(14(19)5-10)15-7-22-17-23-11(8-25(17)24-15)9-26-12-3-4-21-16(20)6-12/h1-8H,9H2 |
| InChIKey | VRDYQASBTHFWTR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|