C7H12N2O2 — CID 122522116
1-amino-3,5-dimethylpiperidine-2,6-dione (PubChem CID 122522116) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 1-amino-3,5-dimethylpiperidine-2,6-dione.
| Compound Name | 1-amino-3,5-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 122522116 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-amino-3,5-dimethylpiperidine-2,6-dione |
| SMILES | CC1CC(C)C(=O)N(N)C1=O |
| InChI | InChI=1S/C7H12N2O2/c1-4-3-5(2)7(11)9(8)6(4)10/h4-5H,3,8H2,1-2H3 |
| InChIKey | QDFPJLDTAWTWTO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|