C15H15N3O3 — CID 122525548
[3-(5-formyl-1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohex-3-en-1-yl]carbamic acid (PubChem CID 122525548) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is [3-(5-formyl-1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohex-3-en-1-yl]carbamic acid.
| Compound Name | [3-(5-formyl-1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohex-3-en-1-yl]carbamic acid |
|---|---|
| PubChem CID | 122525548 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | [3-(5-formyl-1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohex-3-en-1-yl]carbamic acid |
| SMILES | O=Cc1cnc2[nH]ccc2c1C1=CCCC(NC(=O)O)C1 |
| InChI | InChI=1S/C15H15N3O3/c19-8-10-7-17-14-12(4-5-16-14)13(10)9-2-1-3-11(6-9)18-15(20)21/h2,4-5,7-8,11,18H,1,3,6H2,(H,16,17)(H,20,21) |
| InChIKey | OZZMKXWEQBGYFW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|