C22H22N4 — CID 142403691
4-[5-[(3E)-3-(dimethylaminomethylidene)pent-4-en-1-ynyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-ene-1-carbonitrile (PubChem CID 142403691) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-[5-[(3E)-3-(dimethylaminomethylidene)pent-4-en-1-ynyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-ene-1-carbonitrile.
| Compound Name | 4-[5-[(3E)-3-(dimethylaminomethylidene)pent-4-en-1-ynyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 142403691 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-[5-[(3E)-3-(dimethylaminomethylidene)pent-4-en-1-ynyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-ene-1-carbonitrile |
| SMILES | C=C/C(C#Cc1cnc2[nH]ccc2c1C1=CCC(C#N)CC1)=C\N(C)C |
| InChI | InChI=1S/C22H22N4/c1-4-16(15-26(2)3)5-10-19-14-25-22-20(11-12-24-22)21(19)18-8-6-17(13-23)7-9-18/h4,8,11-12,14-15,17H,1,6-7,9H2,2-3H3,(H,24,25)/b16-15+ |
| InChIKey | GMUIWSWNQSEYRQ-FOCLMDBBSA-N |
| XLogP | 4.25 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|