C29H34F3N5 — CID 122527262
1-[4-[4-(4-methylphenyl)piperazin-1-yl]-2-pyridinyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 122527262) has the molecular formula C29H34F3N5 and a molecular weight of 509.62 g/mol. Its IUPAC name is 1-[4-[4-(4-methylphenyl)piperazin-1-yl]-2-pyridinyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1-[4-[4-(4-methylphenyl)piperazin-1-yl]-2-pyridinyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 122527262 |
| Molecular Formula | C29H34F3N5 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 1-[4-[4-(4-methylphenyl)piperazin-1-yl]-2-pyridinyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | Cc1ccc(N2CCN(c3ccnc(N4CCC(Nc5ccc(C)c(C(F)(F)F)c5)CC4)c3)CC2)cc1 |
| InChI | InChI=1S/C29H34F3N5/c1-21-3-7-25(8-4-21)35-15-17-36(18-16-35)26-9-12-33-28(20-26)37-13-10-23(11-14-37)34-24-6-5-22(2)27(19-24)29(30,31)32/h3-9,12,19-20,23,34H,10-11,13-18H2,1-2H3 |
| InChIKey | LKZNIYNGGGOYLN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|