C22H23F2N7O — CID 122536155
4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536155) has the molecular formula C22H23F2N7O and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536155 |
| Molecular Formula | C22H23F2N7O |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | Cc1c[nH]c2ncc(-c3nc(N4CCC(F)(F)C4)c4nc5n(c4n3)CCOC5(C)C)cc12 |
| InChI | InChI=1S/C22H23F2N7O/c1-12-9-25-17-14(12)8-13(10-26-17)16-28-18(30-5-4-22(23,24)11-30)15-19(29-16)31-6-7-32-21(2,3)20(31)27-15/h8-10H,4-7,11H2,1-3H3,(H,25,26) |
| InChIKey | NGBMCVDHGZRNOG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |