C26H33FN2O2S — CID 122537155
2-cycloheptyl-N-cyclopentyl-2-(3-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide (PubChem CID 122537155) has the molecular formula C26H33FN2O2S and a molecular weight of 456.63 g/mol. Its IUPAC name is 2-cycloheptyl-N-cyclopentyl-2-(3-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide.
| Compound Name | 2-cycloheptyl-N-cyclopentyl-2-(3-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
|---|---|
| PubChem CID | 122537155 |
| Molecular Formula | C26H33FN2O2S |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-cycloheptyl-N-cyclopentyl-2-(3-fluoro-N-(2-thiophen-2-ylacetyl)anilino)acetamide |
| SMILES | O=C(NC1CCCC1)C(C1CCCCCC1)N(C(=O)Cc1cccs1)c1cccc(F)c1 |
| InChI | InChI=1S/C26H33FN2O2S/c27-20-11-7-14-22(17-20)29(24(30)18-23-15-8-16-32-23)25(19-9-3-1-2-4-10-19)26(31)28-21-12-5-6-13-21/h7-8,11,14-17,19,21,25H,1-6,9-10,12-13,18H2,(H,28,31) |
| InChIKey | UCFAXNPKKHYZIP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |