C24H32N8O — CID 122541110
2-[2-[(2S,6S)-6-[4-(2-oxo-6-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]piperidin-2-yl]ethyl]guanidine (PubChem CID 122541110) has the molecular formula C24H32N8O and a molecular weight of 448.58 g/mol. Its IUPAC name is 2-[2-[(2S,6S)-6-[4-(2-oxo-6-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]piperidin-2-yl]ethyl]guanidine.
| Compound Name | 2-[2-[(2S,6S)-6-[4-(2-oxo-6-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]piperidin-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 122541110 |
| Molecular Formula | C24H32N8O |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 2-[2-[(2S,6S)-6-[4-(2-oxo-6-pyrrolidin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]piperidin-2-yl]ethyl]guanidine |
| SMILES | NC(N)=NCC[C@@H]1CCC[C@@H](c2ccc(-n3cc4cc(C5CCNC5)[nH]c4nc3=O)cc2)N1 |
| InChI | InChI=1S/C24H32N8O/c25-23(26)28-11-9-18-2-1-3-20(29-18)15-4-6-19(7-5-15)32-14-17-12-21(16-8-10-27-13-16)30-22(17)31-24(32)33/h4-7,12,14,16,18,20,27,29H,1-3,8-11,13H2,(H4,25,26,28)(H,30,31,33)/t16?,18-,20-/m0/s1 |
| InChIKey | WUKDYPMCFJCQLD-WNPSOCMYSA-N |
| XLogP | 1.64 |
| TPSA | 139.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|