C22H29N7O2 — CID 134315250
2-[(3S)-3-[[4-[2-oxo-6-[(3R)-pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]butyl]guanidine (PubChem CID 134315250) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[(3S)-3-[[4-[2-oxo-6-[(3R)-pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]butyl]guanidine.
| Compound Name | 2-[(3S)-3-[[4-[2-oxo-6-[(3R)-pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]butyl]guanidine |
|---|---|
| PubChem CID | 134315250 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 2-[(3S)-3-[[4-[2-oxo-6-[(3R)-pyrrolidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]butyl]guanidine |
| SMILES | C[C@@H](CCN=C(N)N)OCc1ccc(-n2cc3cc([C@@H]4CCNC4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C22H29N7O2/c1-14(6-9-26-21(23)24)31-13-15-2-4-18(5-3-15)29-12-17-10-19(16-7-8-25-11-16)27-20(17)28-22(29)30/h2-5,10,12,14,16,25H,6-9,11,13H2,1H3,(H4,23,24,26)(H,27,28,30)/t14-,16+/m0/s1 |
| InChIKey | PRTYWLDQPNPHTO-GOEBONIOSA-N |
| XLogP | 1.36 |
| TPSA | 136.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|