C32H32FNO5 — CID 122543812
(3S,5R)-5-ethyl-2-(2-fluoro-6-phenylmethoxy-3-pyridinyl)-3,4-bis(phenylmethoxy)oxolan-2-ol (PubChem CID 122543812) has the molecular formula C32H32FNO5 and a molecular weight of 529.61 g/mol. Its IUPAC name is (3S,5R)-5-ethyl-2-(2-fluoro-6-phenylmethoxy-3-pyridinyl)-3,4-bis(phenylmethoxy)oxolan-2-ol.
| Compound Name | (3S,5R)-5-ethyl-2-(2-fluoro-6-phenylmethoxy-3-pyridinyl)-3,4-bis(phenylmethoxy)oxolan-2-ol |
|---|---|
| PubChem CID | 122543812 |
| Molecular Formula | C32H32FNO5 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (3S,5R)-5-ethyl-2-(2-fluoro-6-phenylmethoxy-3-pyridinyl)-3,4-bis(phenylmethoxy)oxolan-2-ol |
| SMILES | CC[C@H]1OC(O)(c2ccc(OCc3ccccc3)nc2F)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C32H32FNO5/c1-2-27-29(37-21-24-14-8-4-9-15-24)30(38-22-25-16-10-5-11-17-25)32(35,39-27)26-18-19-28(34-31(26)33)36-20-23-12-6-3-7-13-23/h3-19,27,29-30,35H,2,20-22H2,1H3/t27-,29?,30+,32?/m1/s1 |
| InChIKey | JJOOIOOPCUFDEP-YKMXPJFQSA-N |
| XLogP | 5.92 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|