C15H22O4S — CID 158397609
(3R,4R,5R)-5-ethyl-4-methoxy-3-phenylmethoxy-2-(sulfanylmethyl)oxolan-2-ol (PubChem CID 158397609) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is (3R,4R,5R)-5-ethyl-4-methoxy-3-phenylmethoxy-2-(sulfanylmethyl)oxolan-2-ol.
| Compound Name | (3R,4R,5R)-5-ethyl-4-methoxy-3-phenylmethoxy-2-(sulfanylmethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 158397609 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (3R,4R,5R)-5-ethyl-4-methoxy-3-phenylmethoxy-2-(sulfanylmethyl)oxolan-2-ol |
| SMILES | CC[C@H]1OC(O)(CS)[C@H](OCc2ccccc2)[C@@H]1OC |
| InChI | InChI=1S/C15H22O4S/c1-3-12-13(17-2)14(15(16,10-20)19-12)18-9-11-7-5-4-6-8-11/h4-8,12-14,16,20H,3,9-10H2,1-2H3/t12-,13-,14-,15?/m1/s1 |
| InChIKey | KWCUKNHZBUMHEW-CBNXCZCTSA-N |
| XLogP | 2.01 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|