C32H32FNO4 — CID 118149175
3-[(2S,4S,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-fluoro-6-phenylmethoxypyridine (PubChem CID 118149175) has the molecular formula C32H32FNO4 and a molecular weight of 513.61 g/mol. Its IUPAC name is 3-[(2S,4S,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-fluoro-6-phenylmethoxypyridine.
| Compound Name | 3-[(2S,4S,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-fluoro-6-phenylmethoxypyridine |
|---|---|
| PubChem CID | 118149175 |
| Molecular Formula | C32H32FNO4 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[(2S,4S,5R)-5-ethyl-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-fluoro-6-phenylmethoxypyridine |
| SMILES | CC[C@H]1O[C@@H](c2ccc(OCc3ccccc3)nc2F)C(OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H32FNO4/c1-2-27-30(36-21-24-14-8-4-9-15-24)31(37-22-25-16-10-5-11-17-25)29(38-27)26-18-19-28(34-32(26)33)35-20-23-12-6-3-7-13-23/h3-19,27,29-31H,2,20-22H2,1H3/t27-,29+,30+,31?/m1/s1 |
| InChIKey | UKZUDOJNEYGJGQ-WZNMFJSQSA-N |
| XLogP | 6.82 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|