C36H22N4O — CID 122547797
6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]chromeno[4,3-b]indole (PubChem CID 122547797) has the molecular formula C36H22N4O and a molecular weight of 526.60 g/mol. Its IUPAC name is 6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]chromeno[4,3-b]indole.
| Compound Name | 6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]chromeno[4,3-b]indole |
|---|---|
| PubChem CID | 122547797 |
| Molecular Formula | C36H22N4O |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]chromeno[4,3-b]indole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4oc5ccccc5c5nc6ccccc6c4-5)c3)n2)cc1 |
| InChI | InChI=1S/C36H22N4O/c1-3-12-23(13-4-1)34-38-35(24-14-5-2-6-15-24)40-36(39-34)26-17-11-16-25(22-26)33-31-27-18-7-9-20-29(27)37-32(31)28-19-8-10-21-30(28)41-33/h1-22H |
| InChIKey | ALNLWEJQHJWPQB-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |