C16H19F6NO — CID 122549176
N-[(2S)-2-methylhexyl]-3,4-bis(trifluoromethyl)benzamide (PubChem CID 122549176) has the molecular formula C16H19F6NO and a molecular weight of 355.32 g/mol. Its IUPAC name is N-[(2S)-2-methylhexyl]-3,4-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-2-methylhexyl]-3,4-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 122549176 |
| Molecular Formula | C16H19F6NO |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[(2S)-2-methylhexyl]-3,4-bis(trifluoromethyl)benzamide |
| SMILES | CCCC[C@H](C)CNC(=O)c1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F6NO/c1-3-4-5-10(2)9-23-14(24)11-6-7-12(15(17,18)19)13(8-11)16(20,21)22/h6-8,10H,3-5,9H2,1-2H3,(H,23,24)/t10-/m0/s1 |
| InChIKey | BEIIUVCHAYDIMX-JTQLQIEISA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |