C21H29N7O — CID 122549706
1-[4-[[4-(4-aminopyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]-3-cyclopentylurea (PubChem CID 122549706) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-[4-[[4-(4-aminopyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]-3-cyclopentylurea.
| Compound Name | 1-[4-[[4-(4-aminopyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]-3-cyclopentylurea |
|---|---|
| PubChem CID | 122549706 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 1-[4-[[4-(4-aminopyrimidin-2-yl)piperazin-1-yl]methyl]phenyl]-3-cyclopentylurea |
| SMILES | Nc1ccnc(N2CCN(Cc3ccc(NC(=O)NC4CCCC4)cc3)CC2)n1 |
| InChI | InChI=1S/C21H29N7O/c22-19-9-10-23-20(26-19)28-13-11-27(12-14-28)15-16-5-7-18(8-6-16)25-21(29)24-17-3-1-2-4-17/h5-10,17H,1-4,11-15H2,(H2,22,23,26)(H2,24,25,29) |
| InChIKey | TUNQVXYNSOAXRY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |