C13H22N4O4S2 — CID 122571957
4-(dimethylsulfamoylamino)-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 122571957) has the molecular formula C13H22N4O4S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-(dimethylsulfamoylamino)-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 4-(dimethylsulfamoylamino)-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 122571957 |
| Molecular Formula | C13H22N4O4S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(dimethylsulfamoylamino)-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(S(=O)(=O)NC2CCNCC2)cc1 |
| InChI | InChI=1S/C13H22N4O4S2/c1-17(2)23(20,21)16-11-3-5-13(6-4-11)22(18,19)15-12-7-9-14-10-8-12/h3-6,12,14-16H,7-10H2,1-2H3 |
| InChIKey | YENQHWFGFJQBSR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |