C14H10ClNO3 — CID 122572999
[4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]carbamic acid (PubChem CID 122572999) has the molecular formula C14H10ClNO3 and a molecular weight of 280.72 g/mol. Its IUPAC name is [4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]carbamic acid.
| Compound Name | [4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 122572999 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [4-chloro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]carbamic acid |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)c2cc(Cl)ccc2NC(=O)O)c([2H])c1[2H] |
| InChI | InChI=1S/C14H10ClNO3/c15-10-6-7-12(16-14(18)19)11(8-10)13(17)9-4-2-1-3-5-9/h1-8,16H,(H,18,19)/i1D,2D,3D,4D,5D |
| InChIKey | HKMMXCWSSPYCII-RALIUCGRSA-N |
| XLogP | 3.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |