C6H9I3 — CID 122583547
1,2,4-triiodocyclohexane (PubChem CID 122583547) has the molecular formula C6H9I3 and a molecular weight of 461.85 g/mol. Its IUPAC name is 1,2,4-triiodocyclohexane.
| Compound Name | 1,2,4-triiodocyclohexane |
|---|---|
| PubChem CID | 122583547 |
| Molecular Formula | C6H9I3 |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.78 |
| IUPAC Name | 1,2,4-triiodocyclohexane |
| SMILES | IC1CCC(I)C(I)C1 |
| InChI | InChI=1S/C6H9I3/c7-4-1-2-5(8)6(9)3-4/h4-6H,1-3H2 |
| InChIKey | MDGTZSHRIZMVNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|