C27H34N4O5S — CID 122588090
3-[3-[(4-cyanophenyl)carbamoylamino]-4-[(2,2-dihydroxythian-4-yl)-propylamino]phenyl]-3-methylbutanoic acid (PubChem CID 122588090) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is 3-[3-[(4-cyanophenyl)carbamoylamino]-4-[(2,2-dihydroxythian-4-yl)-propylamino]phenyl]-3-methylbutanoic acid.
| Compound Name | 3-[3-[(4-cyanophenyl)carbamoylamino]-4-[(2,2-dihydroxythian-4-yl)-propylamino]phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122588090 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 3-[3-[(4-cyanophenyl)carbamoylamino]-4-[(2,2-dihydroxythian-4-yl)-propylamino]phenyl]-3-methylbutanoic acid |
| SMILES | CCCN(c1ccc(C(C)(C)CC(=O)O)cc1NC(=O)Nc1ccc(C#N)cc1)C1CCSC(O)(O)C1 |
| InChI | InChI=1S/C27H34N4O5S/c1-4-12-31(21-11-13-37-27(35,36)15-21)23-10-7-19(26(2,3)16-24(32)33)14-22(23)30-25(34)29-20-8-5-18(17-28)6-9-20/h5-10,14,21,35-36H,4,11-13,15-16H2,1-3H3,(H,32,33)(H2,29,30,34) |
| InChIKey | KGHDHMALIDUEAE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|