C25H31N3O3 — CID 122586327
3-[3-(4-cyanoanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-3-methylbutanoic acid (PubChem CID 122586327) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-[3-(4-cyanoanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-3-methylbutanoic acid.
| Compound Name | 3-[3-(4-cyanoanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122586327 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-[3-(4-cyanoanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-3-methylbutanoic acid |
| SMILES | CCN(c1ccc(C(C)(C)CC(=O)O)cc1Nc1ccc(C#N)cc1)C1CCOCC1 |
| InChI | InChI=1S/C25H31N3O3/c1-4-28(21-11-13-31-14-12-21)23-10-7-19(25(2,3)16-24(29)30)15-22(23)27-20-8-5-18(17-26)6-9-20/h5-10,15,21,27H,4,11-14,16H2,1-3H3,(H,29,30) |
| InChIKey | KMFLWPAXIHYBKM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |