C26H33N3O3 — CID 130331121
2-[3-(4-cyanoanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]butanoic acid (PubChem CID 130331121) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[3-(4-cyanoanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]butanoic acid.
| Compound Name | 2-[3-(4-cyanoanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 130331121 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[3-(4-cyanoanilino)-4-[2-methylpropyl(oxan-4-yl)amino]phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(N(CC(C)C)C2CCOCC2)c(Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-4-23(26(30)31)20-7-10-25(29(17-18(2)3)22-11-13-32-14-12-22)24(15-20)28-21-8-5-19(16-27)6-9-21/h5-10,15,18,22-23,28H,4,11-14,17H2,1-3H3,(H,30,31) |
| InChIKey | RFDGPCYZNPRYCD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |