C33H46N7O5P — CID 122595725
2-[[1-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]diazenyl]-5-nitrobenzonitrile (PubChem CID 122595725) has the molecular formula C33H46N7O5P and a molecular weight of 651.75 g/mol. Its IUPAC name is 2-[[1-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]diazenyl]-5-nitrobenzonitrile.
| Compound Name | 2-[[1-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]diazenyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 122595725 |
| Molecular Formula | C33H46N7O5P |
| Molecular Weight | 651.75 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | 2-[[1-[4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl]diazenyl]-5-nitrobenzonitrile |
| SMILES | COc1cc2c(cc1/N=N/c1ccc([N+](=O)[O-])cc1C#N)C(C)CC(C)(C)N2CCCCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C33H46N7O5P/c1-23(2)39(24(3)4)46(45-17-11-14-34)44-16-10-9-15-38-31-20-32(43-8)30(19-28(31)25(5)21-33(38,6)7)37-36-29-13-12-27(40(41)42)18-26(29)22-35/h12-13,18-20,23-25H,9-11,15-17,21H2,1-8H3/b37-36+ |
| InChIKey | BMXOBTNNKGQKMS-BSRQYYOTSA-N |
| XLogP | 9.06 |
| TPSA | 149.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.75 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|