C24H26IN5O4 — CID 122595947
4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butyl hypoiodite (PubChem CID 122595947) has the molecular formula C24H26IN5O4 and a molecular weight of 575.41 g/mol. Its IUPAC name is 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butyl hypoiodite.
| Compound Name | 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butyl hypoiodite |
|---|---|
| PubChem CID | 122595947 |
| Molecular Formula | C24H26IN5O4 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butyl hypoiodite |
| SMILES | COc1cc2c(cc1/N=N/c1ccc([N+](=O)[O-])cc1C#N)C(C)=CC(C)(C)N2CCCCOI |
| InChI | InChI=1S/C24H26IN5O4/c1-16-14-24(2,3)29(9-5-6-10-34-25)22-13-23(33-4)21(12-19(16)22)28-27-20-8-7-18(30(31)32)11-17(20)15-26/h7-8,11-14H,5-6,9-10H2,1-4H3/b28-27+ |
| InChIKey | WMWVAEUQPOQDRB-BYYHNAKLSA-N |
| XLogP | 7.04 |
| TPSA | 113.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|