C29H45N6O5PS — CID 158698845
N-[4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]quinolin-1-yl]butoxy-propoxyphosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 158698845) has the molecular formula C29H45N6O5PS and a molecular weight of 620.76 g/mol. Its IUPAC name is N-[4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]quinolin-1-yl]butoxy-propoxyphosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]quinolin-1-yl]butoxy-propoxyphosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 158698845 |
| Molecular Formula | C29H45N6O5PS |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | N-[4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]quinolin-1-yl]butoxy-propoxyphosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CCCOP(OCCCCN1c2cc(OC)c(/N=N/c3ncc([N+](=O)[O-])s3)cc2C(C)=CC1(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C29H45N6O5PS/c1-10-14-39-41(34(20(2)3)21(4)5)40-15-12-11-13-33-25-17-26(38-9)24(16-23(25)22(6)18-29(33,7)8)31-32-28-30-19-27(42-28)35(36)37/h16-21H,10-15H2,1-9H3/b32-31+ |
| InChIKey | USEBNFBXBKMANU-QNEJGDQOSA-N |
| XLogP | 9.05 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|