C20H25N5O5S — CID 122590154
4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]-3,4-dihydro-1H-quinolin-3-yl]butanoic acid (PubChem CID 122590154) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is 4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]-3,4-dihydro-1H-quinolin-3-yl]butanoic acid.
| Compound Name | 4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]-3,4-dihydro-1H-quinolin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 122590154 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-[7-methoxy-2,2,4-trimethyl-6-[(5-nitro-1,3-thiazol-2-yl)diazenyl]-3,4-dihydro-1H-quinolin-3-yl]butanoic acid |
| SMILES | COc1cc2c(cc1/N=N/c1ncc([N+](=O)[O-])s1)C(C)C(CCCC(=O)O)C(C)(C)N2 |
| InChI | InChI=1S/C20H25N5O5S/c1-11-12-8-15(23-24-19-21-10-17(31-19)25(28)29)16(30-4)9-14(12)22-20(2,3)13(11)6-5-7-18(26)27/h8-11,13,22H,5-7H2,1-4H3,(H,26,27)/b24-23+ |
| InChIKey | HADHAIWUXKWGGK-WCWDXBQESA-N |
| XLogP | 5.65 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|