C26H30ClN5O5 — CID 145163531
4-[6-[(2-chloro-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butanoic acid;propanenitrile (PubChem CID 145163531) has the molecular formula C26H30ClN5O5 and a molecular weight of 528.01 g/mol. Its IUPAC name is 4-[6-[(2-chloro-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butanoic acid;propanenitrile.
| Compound Name | 4-[6-[(2-chloro-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butanoic acid;propanenitrile |
|---|---|
| PubChem CID | 145163531 |
| Molecular Formula | C26H30ClN5O5 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 4-[6-[(2-chloro-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethylquinolin-1-yl]butanoic acid;propanenitrile |
| SMILES | CCC#N.COc1cc2c(cc1/N=N/c1ccc([N+](=O)[O-])cc1Cl)C(C)=CC(C)(C)N2CCCC(=O)O |
| InChI | InChI=1S/C23H25ClN4O5.C3H5N/c1-14-13-23(2,3)27(9-5-6-22(29)30)20-12-21(33-4)19(11-16(14)20)26-25-18-8-7-15(28(31)32)10-17(18)24;1-2-3-4/h7-8,10-13H,5-6,9H2,1-4H3,(H,29,30);2H2,1H3/b26-25+; |
| InChIKey | LTVCADJVCJFCSL-BTKVJIOYSA-N |
| XLogP | 7.46 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|