C34H49N6O6P — CID 122595747
2-[[1-[4-[[di(propan-2-yl)amino]-propoxyphosphanyl]oxybutyl]-5,7-dimethoxy-2,2,4-trimethylquinolin-6-yl]diazenyl]-5-nitrobenzonitrile (PubChem CID 122595747) has the molecular formula C34H49N6O6P and a molecular weight of 668.78 g/mol. Its IUPAC name is 2-[[1-[4-[[di(propan-2-yl)amino]-propoxyphosphanyl]oxybutyl]-5,7-dimethoxy-2,2,4-trimethylquinolin-6-yl]diazenyl]-5-nitrobenzonitrile.
| Compound Name | 2-[[1-[4-[[di(propan-2-yl)amino]-propoxyphosphanyl]oxybutyl]-5,7-dimethoxy-2,2,4-trimethylquinolin-6-yl]diazenyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 122595747 |
| Molecular Formula | C34H49N6O6P |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | 2-[[1-[4-[[di(propan-2-yl)amino]-propoxyphosphanyl]oxybutyl]-5,7-dimethoxy-2,2,4-trimethylquinolin-6-yl]diazenyl]-5-nitrobenzonitrile |
| SMILES | CCCOP(OCCCCN1c2cc(OC)c(/N=N/c3ccc([N+](=O)[O-])cc3C#N)c(OC)c2C(C)=CC1(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C34H49N6O6P/c1-11-17-45-47(39(23(2)3)24(4)5)46-18-13-12-16-38-29-20-30(43-9)32(33(44-10)31(29)25(6)21-34(38,7)8)37-36-28-15-14-27(40(41)42)19-26(28)22-35/h14-15,19-21,23-24H,11-13,16-18H2,1-10H3/b37-36+ |
| InChIKey | JUAVKRVLQDRPCA-BSRQYYOTSA-N |
| XLogP | 9.47 |
| TPSA | 135.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|