C21H22FN3O6 — CID 122595872
tert-butyl N-[(2S)-1-(N-(2-fluoro-6-nitrobenzoyl)anilino)-1-oxopropan-2-yl]carbamate (PubChem CID 122595872) has the molecular formula C21H22FN3O6 and a molecular weight of 431.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(N-(2-fluoro-6-nitrobenzoyl)anilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(N-(2-fluoro-6-nitrobenzoyl)anilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 122595872 |
| Molecular Formula | C21H22FN3O6 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-(N-(2-fluoro-6-nitrobenzoyl)anilino)-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N(C(=O)c1c(F)cccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C21H22FN3O6/c1-13(23-20(28)31-21(2,3)4)18(26)24(14-9-6-5-7-10-14)19(27)17-15(22)11-8-12-16(17)25(29)30/h5-13H,1-4H3,(H,23,28)/t13-/m0/s1 |
| InChIKey | PXFQCVGHSVJYTH-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|