C22H22BrNO3 — CID 122605075
(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-8-propan-2-yl-3,3a,4,5,8,9b-hexahydrocyclopenta[c]quinolin-9-one (PubChem CID 122605075) has the molecular formula C22H22BrNO3 and a molecular weight of 428.33 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-8-propan-2-yl-3,3a,4,5,8,9b-hexahydrocyclopenta[c]quinolin-9-one.
| Compound Name | (3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-8-propan-2-yl-3,3a,4,5,8,9b-hexahydrocyclopenta[c]quinolin-9-one |
|---|---|
| PubChem CID | 122605075 |
| Molecular Formula | C22H22BrNO3 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-8-propan-2-yl-3,3a,4,5,8,9b-hexahydrocyclopenta[c]quinolin-9-one |
| SMILES | CC(C)C1C=CC2=C(C1=O)[C@@H]1C=CC[C@@H]1[C@H](c1cc3c(cc1Br)OCO3)N2 |
| InChI | InChI=1S/C22H22BrNO3/c1-11(2)12-6-7-17-20(22(12)25)13-4-3-5-14(13)21(24-17)15-8-18-19(9-16(15)23)27-10-26-18/h3-4,6-9,11-14,21,24H,5,10H2,1-2H3/t12?,13-,14+,21-/m1/s1 |
| InChIKey | KPWMNRRTSFRLHQ-OTZKEZBESA-N |
| XLogP | 4.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|