C29H28BrN3O3 — CID 166945522
1-[2-[(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethyl]-3-(3-methylphenyl)urea (PubChem CID 166945522) has the molecular formula C29H28BrN3O3 and a molecular weight of 546.47 g/mol. Its IUPAC name is 1-[2-[(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[2-[(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 166945522 |
| Molecular Formula | C29H28BrN3O3 |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[2-[(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NCCc2ccc3c(c2)[C@@H]2C=CC[C@@H]2[C@H](c2cc4c(cc2Br)OCO4)N3)c1 |
| InChI | InChI=1S/C29H28BrN3O3/c1-17-4-2-5-19(12-17)32-29(34)31-11-10-18-8-9-25-22(13-18)20-6-3-7-21(20)28(33-25)23-14-26-27(15-24(23)30)36-16-35-26/h2-6,8-9,12-15,20-21,28,33H,7,10-11,16H2,1H3,(H2,31,32,34)/t20-,21+,28-/m1/s1 |
| InChIKey | KRRHRKSSLVHMSV-PHVLTXCSSA-N |
| XLogP | 6.68 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|