C31H42BrNO2Sn — CID 46180587
[(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-7-yl]-tributylstannane (PubChem CID 46180587) has the molecular formula C31H42BrNO2Sn and a molecular weight of 659.30 g/mol. Its IUPAC name is [(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-7-yl]-tributylstannane.
| Compound Name | [(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-7-yl]-tributylstannane |
|---|---|
| PubChem CID | 46180587 |
| Molecular Formula | C31H42BrNO2Sn |
| Molecular Weight | 659.30 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | [(3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-7-yl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2c(c1)N[C@@H](c1cc3c(cc1Br)OCO3)[C@H]1CC=C[C@@H]21 |
| InChI | InChI=1S/C19H15BrNO2.3C4H9.Sn/c20-15-9-18-17(22-10-23-18)8-14(15)19-13-6-3-5-11(13)12-4-1-2-7-16(12)21-19;3*1-3-4-2;/h1,3-5,7-9,11,13,19,21H,6,10H2;3*1,3-4H2,2H3;/t11-,13-,19+;;;;/m0..../s1 |
| InChIKey | RWDWFXDHQYGZHK-BHMIARKRSA-N |
| XLogP | 9.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.30 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|