C30H31BrN4O4 — CID 71215341
tert-butyl 2-[2-[5-[4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-pyridinyl]hydrazinyl]acetate (PubChem CID 71215341) has the molecular formula C30H31BrN4O4 and a molecular weight of 591.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[5-[4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-pyridinyl]hydrazinyl]acetate.
| Compound Name | tert-butyl 2-[2-[5-[4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-pyridinyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 71215341 |
| Molecular Formula | C30H31BrN4O4 |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | tert-butyl 2-[2-[5-[4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-2-pyridinyl]hydrazinyl]acetate |
| SMILES | CC(C)(C)OC(=O)CNNc1ccc(-c2ccc3c(c2)C2C=CCC2C(c2cc4c(cc2Br)OCO4)N3)cn1 |
| InChI | InChI=1S/C30H31BrN4O4/c1-30(2,3)39-28(36)15-33-35-27-10-8-18(14-32-27)17-7-9-24-21(11-17)19-5-4-6-20(19)29(34-24)22-12-25-26(13-23(22)31)38-16-37-25/h4-5,7-14,19-20,29,33-34H,6,15-16H2,1-3H3,(H,32,35) |
| InChIKey | ZWALDTGEAXAMPZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|