C16H16N2O9 — CID 122607143
1-O-[3-(2,4-dioxo-1H-pyrimidin-6-yl)propyl] 4-O-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-but-2-enedioate (PubChem CID 122607143) has the molecular formula C16H16N2O9 and a molecular weight of 380.31 g/mol. Its IUPAC name is 1-O-[3-(2,4-dioxo-1H-pyrimidin-6-yl)propyl] 4-O-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-[3-(2,4-dioxo-1H-pyrimidin-6-yl)propyl] 4-O-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122607143 |
| Molecular Formula | C16H16N2O9 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-O-[3-(2,4-dioxo-1H-pyrimidin-6-yl)propyl] 4-O-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-but-2-enedioate |
| SMILES | Cc1oc(=O)oc1COC(=O)/C=C/C(=O)OCCCc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C16H16N2O9/c1-9-11(27-16(23)26-9)8-25-14(21)5-4-13(20)24-6-2-3-10-7-12(19)18-15(22)17-10/h4-5,7H,2-3,6,8H2,1H3,(H2,17,18,19,22)/b5-4+ |
| InChIKey | BVERNDDWHCENOT-SNAWJCMRSA-N |
| XLogP | -0.31 |
| TPSA | 161.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|