C21H16Cl3N3O2 — CID 122615453
2-chloro-N-(1-cyanocyclopropyl)-5-[[(1S,3S)-2,2-dichloro-3-phenylcyclopropanecarbonyl]amino]benzamide (PubChem CID 122615453) has the molecular formula C21H16Cl3N3O2 and a molecular weight of 448.74 g/mol. Its IUPAC name is 2-chloro-N-(1-cyanocyclopropyl)-5-[[(1S,3S)-2,2-dichloro-3-phenylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[[(1S,3S)-2,2-dichloro-3-phenylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 122615453 |
| Molecular Formula | C21H16Cl3N3O2 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-chloro-N-(1-cyanocyclopropyl)-5-[[(1S,3S)-2,2-dichloro-3-phenylcyclopropanecarbonyl]amino]benzamide |
| SMILES | N#CC1(NC(=O)c2cc(NC(=O)[C@@H]3[C@@H](c4ccccc4)C3(Cl)Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C21H16Cl3N3O2/c22-15-7-6-13(10-14(15)18(28)27-20(11-25)8-9-20)26-19(29)17-16(21(17,23)24)12-4-2-1-3-5-12/h1-7,10,16-17H,8-9H2,(H,26,29)(H,27,28)/t16-,17+/m1/s1 |
| InChIKey | GNBQWQPSHMGPFV-SJORKVTESA-N |
| XLogP | 4.65 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|