C26H26N6O3 — CID 122622308
1-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)piperidin-4-ol (PubChem CID 122622308) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 1-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)piperidin-4-ol.
| Compound Name | 1-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 122622308 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1-(5-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,4'-2,3-dihydrochromene]-4-ylpyrimidin-2-yl)piperidin-4-ol |
| SMILES | OC1CCN(c2ncc(-c3ccc4nc5n(c4n3)C3(CCOc4ccccc43)COC5)cn2)CC1 |
| InChI | InChI=1S/C26H26N6O3/c33-18-7-10-31(11-8-18)25-27-13-17(14-28-25)20-5-6-21-24(30-20)32-23(29-21)15-34-16-26(32)9-12-35-22-4-2-1-3-19(22)26/h1-6,13-14,18,33H,7-12,15-16H2 |
| InChIKey | NLEIKEMFCDPOTF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |