C23H22N6O — CID 122621739
4-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]morpholine (PubChem CID 122621739) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 122621739 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[5-(3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyrimidin-2-yl]morpholine |
| SMILES | c1ccc(C2CCc3nc4ccc(-c5cnc(N6CCOCC6)nc5)nc4n32)cc1 |
| InChI | InChI=1S/C23H22N6O/c1-2-4-16(5-3-1)20-8-9-21-26-19-7-6-18(27-22(19)29(20)21)17-14-24-23(25-15-17)28-10-12-30-13-11-28/h1-7,14-15,20H,8-13H2 |
| InChIKey | PKKGTVZKWRRBLK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |