C25H24N4O2 — CID 122622144
(3R)-11-[2-(oxan-4-yloxy)-4-pyridinyl]-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene (PubChem CID 122622144) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (3R)-11-[2-(oxan-4-yloxy)-4-pyridinyl]-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene.
| Compound Name | (3R)-11-[2-(oxan-4-yloxy)-4-pyridinyl]-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
|---|---|
| PubChem CID | 122622144 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (3R)-11-[2-(oxan-4-yloxy)-4-pyridinyl]-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
| SMILES | c1ccc([C@H]2CCc3nc4ccc(-c5ccnc(OC6CCOCC6)c5)nc4n32)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-4-17(5-3-1)22-8-9-23-27-21-7-6-20(28-25(21)29(22)23)18-10-13-26-24(16-18)31-19-11-14-30-15-12-19/h1-7,10,13,16,19,22H,8-9,11-12,14-15H2/t22-/m1/s1 |
| InChIKey | KMPJLWGAXXHOSP-JOCHJYFZSA-N |
| XLogP | 4.59 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |