C27H26N4O4 — CID 122622214
4-[(4-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-yl-2-pyridinyl)oxy]cyclohexan-1-ol (PubChem CID 122622214) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[(4-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-yl-2-pyridinyl)oxy]cyclohexan-1-ol.
| Compound Name | 4-[(4-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-yl-2-pyridinyl)oxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 122622214 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-[(4-spiro[11-oxa-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-13,3'-2H-1-benzofuran]-4-yl-2-pyridinyl)oxy]cyclohexan-1-ol |
| SMILES | OC1CCC(Oc2cc(-c3ccc4nc5n(c4n3)C3(COC5)COc4ccccc43)ccn2)CC1 |
| InChI | InChI=1S/C27H26N4O4/c32-18-5-7-19(8-6-18)35-25-13-17(11-12-28-25)21-9-10-22-26(30-21)31-24(29-22)14-33-15-27(31)16-34-23-4-2-1-3-20(23)27/h1-4,9-13,18-19,32H,5-8,14-16H2 |
| InChIKey | DXJWOUCDQLXWKI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |