C26H26N4O2 — CID 122622061
4-[[4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol (PubChem CID 122622061) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[[4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol.
| Compound Name | 4-[[4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 122622061 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-[[4-[(3R)-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol |
| SMILES | OC1CCC(Oc2cc(-c3ccc4nc5n(c4n3)[C@@H](c3ccccc3)CC5)ccn2)CC1 |
| InChI | InChI=1S/C26H26N4O2/c31-19-6-8-20(9-7-19)32-25-16-18(14-15-27-25)21-10-11-22-26(29-21)30-23(12-13-24(30)28-22)17-4-2-1-3-5-17/h1-5,10-11,14-16,19-20,23,31H,6-9,12-13H2/t19?,20?,23-/m1/s1 |
| InChIKey | HBEZAJJNGHSLPC-YABDQXBESA-N |
| XLogP | 4.71 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |