C15H12BrN3 — CID 122622000
11-bromo-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene (PubChem CID 122622000) has the molecular formula C15H12BrN3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 11-bromo-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene.
| Compound Name | 11-bromo-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
|---|---|
| PubChem CID | 122622000 |
| Molecular Formula | C15H12BrN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 11-bromo-3-phenyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
| SMILES | Brc1ccc2nc3n(c2n1)C(c1ccccc1)CC3 |
| InChI | InChI=1S/C15H12BrN3/c16-13-8-6-11-15(18-13)19-12(7-9-14(19)17-11)10-4-2-1-3-5-10/h1-6,8,12H,7,9H2 |
| InChIKey | OLYNDUMSXLGKIV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|