C16H14BrN3O — CID 145172000
(10R,13R)-4-bromo-13-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-ol (PubChem CID 145172000) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is (10R,13R)-4-bromo-13-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-ol.
| Compound Name | (10R,13R)-4-bromo-13-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-ol |
|---|---|
| PubChem CID | 145172000 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | (10R,13R)-4-bromo-13-phenyl-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-ol |
| SMILES | O[C@@H]1CC[C@H](c2ccccc2)n2c1nc1ccc(Br)nc12 |
| InChI | InChI=1S/C16H14BrN3O/c17-14-9-6-11-15(19-14)20-12(10-4-2-1-3-5-10)7-8-13(21)16(20)18-11/h1-6,9,12-13,21H,7-8H2/t12-,13-/m1/s1 |
| InChIKey | VFBCMWYGQRFRJG-CHWSQXEVSA-N |
| XLogP | 3.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|