C27H26N4O2 — CID 122622287
7-[2-(oxan-4-yloxy)-4-pyridinyl]-11-phenyl-3,8,10-triazatetracyclo[10.1.1.02,10.04,9]tetradeca-2,4(9),5,7-tetraene (PubChem CID 122622287) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 7-[2-(oxan-4-yloxy)-4-pyridinyl]-11-phenyl-3,8,10-triazatetracyclo[10.1.1.02,10.04,9]tetradeca-2,4(9),5,7-tetraene.
| Compound Name | 7-[2-(oxan-4-yloxy)-4-pyridinyl]-11-phenyl-3,8,10-triazatetracyclo[10.1.1.02,10.04,9]tetradeca-2,4(9),5,7-tetraene |
|---|---|
| PubChem CID | 122622287 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 7-[2-(oxan-4-yloxy)-4-pyridinyl]-11-phenyl-3,8,10-triazatetracyclo[10.1.1.02,10.04,9]tetradeca-2,4(9),5,7-tetraene |
| SMILES | c1ccc(C2C3CC(C3)c3nc4ccc(-c5ccnc(OC6CCOCC6)c5)nc4n32)cc1 |
| InChI | InChI=1S/C27H26N4O2/c1-2-4-17(5-3-1)25-19-14-20(15-19)26-30-23-7-6-22(29-27(23)31(25)26)18-8-11-28-24(16-18)33-21-9-12-32-13-10-21/h1-8,11,16,19-21,25H,9-10,12-15H2 |
| InChIKey | ICOGTHDPACOZSF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |