C21H24N4O2 — CID 152915404
4-[[4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol (PubChem CID 152915404) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-[[4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol.
| Compound Name | 4-[[4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 152915404 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-[[4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-2-pyridinyl]oxy]cyclohexan-1-ol |
| SMILES | C[C@H]1CCc2nc3ccc(-c4ccnc(OC5CCC(O)CC5)c4)nc3n21 |
| InChI | InChI=1S/C21H24N4O2/c1-13-2-9-19-23-18-8-7-17(24-21(18)25(13)19)14-10-11-22-20(12-14)27-16-5-3-15(26)4-6-16/h7-8,10-13,15-16,26H,2-6,9H2,1H3/t13-,15?,16?/m0/s1 |
| InChIKey | UIAMALMYGMTBME-JEYLPNPQSA-N |
| XLogP | 3.68 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |